cas: 5683-43-2 — see every product listed under this CAS number, including other names
2-Methyl-6-nitro-1,3-benzoxazole, 98%, 98% (CAS 5683-43-2) is a chemical reagent available from Chemat. Available pack sizes: 50g, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EAD1-50g |
| cas | 5683-43-2 |
| size | 50g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 246.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 160.40 Pln | |
| Chemat | 100g | 424.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-methyl-6-nitro-1,3-benzoxazole (CAS 5683-43-2) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-methyl-6-nitro-1,3-benzoxazole. InChIKey: DPVZLXWUFYMLBK-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-methyl-6-nitro-1,3-benzoxazole |
| InChIKey | DPVZLXWUFYMLBK-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(O1)C=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)