cas: 24851-69-2 — see every product listed under this CAS number, including other names
2-Methyl-benzothiazole-5-carboxylic acid, 96% (CAS 24851-69-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F028302-250MG |
| cas | 24851-69-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 726.85 Pln | |
| Fluorochem | 10g | 1362.04 Pln | |
| Fluorochem | 25g | 3309.27 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
2-methyl-1,3-benzothiazole-5-carboxylic acid (CAS 24851-69-2) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-5-carboxylic acid. InChIKey: TVUFPZOJUJGDDD-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazole-5-carboxylic acid |
| InChIKey | TVUFPZOJUJGDDD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)