CAS 4430-47-1 appears in our catalog under these names: 3,4-(Methylenedioxy)benzyl isothiocyanate, 95%, 1,3-Benzodioxol-5-ylmethyl isothiocyanate, 95% , 3,4-Methylenedioxybenzyl isothiocyanate, 99%+(GC-MS),RG. Offered by: Combi-blocks, Thermo Scientific, Fluorochem. Available pack sizes: 1g, 5g.
5-(isothiocyanatomethyl)-1,3-benzodioxole (CAS 4430-47-1) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 5-(isothiocyanatomethyl)-1,3-benzodioxole. InChIKey: PUJWRDBPAFJUJW-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 5-(isothiocyanatomethyl)-1,3-benzodioxole |
| InChIKey | PUJWRDBPAFJUJW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CN=C=S |
Computed by PubChem (NCBI)