CAS 3125-66-4 appears in our catalog under these names: 3-Methoxycarbonylphenyl isothiocyanate, 95%, 3-Methoxycarbonylphenylisothiocyanate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
Methyl 3-isothiocyanatobenzoate (CAS 3125-66-4) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: methyl 3-isothiocyanatobenzoate. InChIKey: NQXFZEJJHPUMMF-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | methyl 3-isothiocyanatobenzoate |
| InChIKey | NQXFZEJJHPUMMF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)N=C=S |
Computed by PubChem (NCBI)