CAS 24851-69-2 appears in our catalog under these names: 2–Methylbenzo(d)thiazole–5–carboxylic acid, 2-Methyl-benzothiazole-5-carboxylic acid, 96%, 2-Methyl-1,3-benzothiazole-5-carboxylic acid, 97%, 2-Methylbenzo[d]thiazole-5-carboxylic acid 95%, 2-Methylbenzo[d]Thiazole-5-Carboxylic Acid, 95%, 95%. Offered by: GLPBio, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100mg.
2-methyl-1,3-benzothiazole-5-carboxylic acid (CAS 24851-69-2) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 2-methyl-1,3-benzothiazole-5-carboxylic acid. InChIKey: TVUFPZOJUJGDDD-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 2-methyl-1,3-benzothiazole-5-carboxylic acid |
| InChIKey | TVUFPZOJUJGDDD-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(S1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)