CAS 345906-72-1 appears in our catalog under these names: Methyl 2-nitrilo-3-(3-thienyl)prop-2-enoate, 95%, Methyl 2–cyano–3–(thiophen–3–yl)acrylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Methyl (Z)-2-cyano-3-thiophen-3-ylprop-2-enoate (CAS 345906-72-1) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: methyl (Z)-2-cyano-3-thiophen-3-ylprop-2-enoate. InChIKey: BBWRETCASAWRII-YWEYNIOJSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | methyl (Z)-2-cyano-3-thiophen-3-ylprop-2-enoate |
| InChIKey | BBWRETCASAWRII-YWEYNIOJSA-N |
| SMILES | COC(=O)/C(=C\C1=CSC=C1)/C#N |
Computed by PubChem (NCBI)