CAS 141492-50-4 appears in our catalog under these names: 6-Isothiocyanato-2,3-dihydro-1,4-benzodioxine, 98%, 2,3-Dihydro-1,4-benzodioxin-6-yl-isothiocyanate, 95%, 6–isothiocyanato–2,3–dihydro–1,4–benzodioxine, 6-isothiocyanato-2,3-dihydro-1,4-benzodioxine, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-isothiocyanato-2,3-dihydro-1,4-benzodioxine (CAS 141492-50-4) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 6-isothiocyanato-2,3-dihydro-1,4-benzodioxine. InChIKey: KALNNFRLHRAJNK-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 6-isothiocyanato-2,3-dihydro-1,4-benzodioxine |
| InChIKey | KALNNFRLHRAJNK-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)N=C=S |
Computed by PubChem (NCBI)