Products 72078-42-3
CAS 72078-42-3 appears in our catalog under these names: 5-(Thiophen-3-yl)-1h-pyrrole-2-carboxylic acid, 95%, 5–(Thiophen–3–yl)–1H–pyrrole–2–carboxylic acid, 5-(Thiophen-3-yl)-1H-pyrrole-2-carboxylic acid 97%, 5-(Thiophen-3-yl)-1H-pyrrole-2-carboxylic acid, 97%, 97%, 5-(Thiophen-3-yl)-1H-pyrrole-2-carboxylic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 50mg.
5-thiophen-3-yl-1H-pyrrole-2-carboxylic acid (CAS 72078-42-3) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: 5-thiophen-3-yl-1H-pyrrole-2-carboxylic acid. InChIKey: ANHBXSDONFXAEI-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | 5-thiophen-3-yl-1H-pyrrole-2-carboxylic acid |
| InChIKey | ANHBXSDONFXAEI-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=CC=C(N2)C(=O)O |
Computed by PubChem (NCBI)