cas: 16957-79-2 — see every product listed under this CAS number, including other names
2-Methylbenzo[b]thiophen-3(2H)-one 1,1-dioxide 95% (CAS 16957-79-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1187169-25mg |
| cas | 16957-79-2 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 331.44 Pln | |
| Ambeed | 50mg | 503.88 Pln | |
| Ambeed | 100mg | 798.69 Pln | |
| Ambeed | 250mg | 1388.31 Pln | |
| Ambeed | 1g | 3529.88 Pln | |
| Ambeed | 5g | 13898.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1187169 |
2-methyl-1,1-dioxo-1-benzothiophen-3-one (CAS 16957-79-2) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 2-methyl-1,1-dioxo-1-benzothiophen-3-one. InChIKey: MQLDRFDZRIIXAS-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-1-benzothiophen-3-one |
| InChIKey | MQLDRFDZRIIXAS-UHFFFAOYSA-N |
| SMILES | CC1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)