cas: 16957-79-2 — see every product listed under this CAS number, including other names
2-methyl-2,3-dihydro-1lambda6-benzothiophene-1,1,3-trione, 95%, 95% (CAS 16957-79-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FLKP-25mg |
| cas | 16957-79-2 |
| size | 25mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 453.20 Pln | |
| Chemat | 50mg | 722.00 Pln | |
| Chemat | 100mg | 995.60 Pln | |
| Chemat | 250mg | 1182.80 Pln | |
| Chemat | 1g | 3453.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-methyl-1,1-dioxo-1-benzothiophen-3-one (CAS 16957-79-2) is a chemical compound with the molecular formula C9H8O3S and a molecular weight of 196.22 g/mol. IUPAC name: 2-methyl-1,1-dioxo-1-benzothiophen-3-one. InChIKey: MQLDRFDZRIIXAS-UHFFFAOYSA-N.
| Molecular formula | C9H8O3S |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 2-methyl-1,1-dioxo-1-benzothiophen-3-one |
| InChIKey | MQLDRFDZRIIXAS-UHFFFAOYSA-N |
| SMILES | CC1C(=O)C2=CC=CC=C2S1(=O)=O |
Computed by PubChem (NCBI)