cas: 185989-39-3 — see every product listed under this CAS number, including other names
2-Naphthalenecarboxylic acid, 3,5-dihydroxy-, methyl ester, 95%, 95% (CAS 185989-39-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118SRY-50mg |
| cas | 185989-39-3 |
| size | 50mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 578.00 Pln | |
| Chemat | 100mg | 736.40 Pln | |
| Chemat | 250mg | 1403.60 Pln | |
| Chemat | 1g | 3419.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 3,5-dihydroxynaphthalene-2-carboxylate (CAS 185989-39-3) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: methyl 3,5-dihydroxynaphthalene-2-carboxylate. InChIKey: ARAZFUMSUAUJRS-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | methyl 3,5-dihydroxynaphthalene-2-carboxylate |
| InChIKey | ARAZFUMSUAUJRS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2C(=C1)C=CC=C2O)O |
Computed by PubChem (NCBI)