cas: 185989-39-3 — see every product listed under this CAS number, including other names
Methyl 3,5-dihydroxy-2-naphthoate 95% (CAS 185989-39-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A207919-50mg |
| cas | 185989-39-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 793.12 Pln | |
| Ambeed | 100mg | 937.75 Pln | |
| Ambeed | 250mg | 1115.75 Pln | |
| Ambeed | 1g | 2695.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A207919 |
Methyl 3,5-dihydroxynaphthalene-2-carboxylate (CAS 185989-39-3) is a chemical compound with the molecular formula C12H10O4 and a molecular weight of 218.20 g/mol. IUPAC name: methyl 3,5-dihydroxynaphthalene-2-carboxylate. InChIKey: ARAZFUMSUAUJRS-UHFFFAOYSA-N.
| Molecular formula | C12H10O4 |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | methyl 3,5-dihydroxynaphthalene-2-carboxylate |
| InChIKey | ARAZFUMSUAUJRS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2C(=C1)C=CC=C2O)O |
Computed by PubChem (NCBI)