cas: 4920-77-8 — see every product listed under this CAS number, including other names
2-Nitro-3-methylphenol, 98%, 98% (CAS 4920-77-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9U8-5g |
| cas | 4920-77-8 |
| size | 5g |
| availability | 149.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 112.40 Pln | |
| Chemat | 100g | 285.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-methyl-2-nitrophenol (CAS 4920-77-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-2-nitrophenol. InChIKey: QIORDSKCCHRSSD-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-2-nitrophenol |
| InChIKey | QIORDSKCCHRSSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)