cas: 4920-77-8 — see every product listed under this CAS number, including other names
3-Methyl-2-nitrophenol, 99.55% (CAS 4920-77-8) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 25 g, 5 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W006081-10 g |
| cas | 4920-77-8 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 287.18 Pln | |
| MedChemExpress | 25 g | 375.42 Pln | |
| MedChemExpress | 5 g | 240.74 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.55% |
3-methyl-2-nitrophenol (CAS 4920-77-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-2-nitrophenol. InChIKey: QIORDSKCCHRSSD-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-2-nitrophenol |
| InChIKey | QIORDSKCCHRSSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)