cas: 4920-77-8 — see every product listed under this CAS number, including other names
3-Methyl-2-nitrophenol, 95% (CAS 4920-77-8) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035814-10G |
| cas | 4920-77-8 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 112.48 Pln | |
| Fluorochem | 25g | 128.10 Pln | |
| Fluorochem | 100g | 351.98 Pln | |
| Fluorochem | 500g | 1528.65 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
3-methyl-2-nitrophenol (CAS 4920-77-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-2-nitrophenol. InChIKey: QIORDSKCCHRSSD-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-2-nitrophenol |
| InChIKey | QIORDSKCCHRSSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)