cas: 4920-77-8 — see every product listed under this CAS number, including other names
2-Nitro-m-cresol, >98.0%(GC)(T) (CAS 4920-77-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | N0552-5G |
| cas | 4920-77-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 188.68 Pln | |
| TCI | 25g | 341.11 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
3-methyl-2-nitrophenol (CAS 4920-77-8) is a chemical compound with the molecular formula C7H7NO3 and a molecular weight of 153.14 g/mol. IUPAC name: 3-methyl-2-nitrophenol. InChIKey: QIORDSKCCHRSSD-UHFFFAOYSA-N.
| Molecular formula | C7H7NO3 |
|---|---|
| Molecular weight | 153.14 g/mol |
| IUPAC name | 3-methyl-2-nitrophenol |
| InChIKey | QIORDSKCCHRSSD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)