2-Nitro-5-methylbenzoic acid, 98%, 98%
cas: 3113-72-2 — see every product listed under this CAS number, including other names
2-Nitro-5-methylbenzoic acid, 98%, 98% (CAS 3113-72-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 100g, 500g, 5g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114MV9-1g |
| cas | 3113-72-2 |
| size | 1g |
| availability | 5000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 69.20 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 83.60 Pln | |
| Chemat | 500g | 206.40 Pln | |
| Chemat | 5g | 74.00 Pln | |
| Chemat | 1kg | 290.00 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-methyl-2-nitrobenzoic acid (CAS 3113-72-2) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 5-methyl-2-nitrobenzoic acid. InChIKey: QRRSIFNWHCKMSW-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 5-methyl-2-nitrobenzoic acid |
| InChIKey | QRRSIFNWHCKMSW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-Methyl-2-nitrobenzoic acid, 2-Nitro-5-methylbenzoic acid, Benzoic acid, 5-methyl-2-nitro-, 3-Methyl-6-nitrobenzoic acid, 6-Nitro-m-toluic acid, m-Toluic acid, 6-nitro-, InChI=1/C8H7NO4/c1-5-2-3-7(9(12)13)6(4-5)8(10)11/h2-4H,1H3,(H,10,11, QRRSIFNWHCKMSW-UHFFFAOYSA-N, 5-Methyl-2-nitro-benzoic acid, 6-Nitro-p-toluic acid