cas: 291289-41-3 — see every product listed under this CAS number, including other names
2-Oxo-2,3-dihydro-1H-benzo[d]imidazole-4-carboxylic acid, 97%, 97% (CAS 291289-41-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113XF9-100mg |
| cas | 291289-41-3 |
| size | 100mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 650.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid (CAS 291289-41-3) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid. InChIKey: NEGPAVSXSLHMAR-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 2-oxo-1,3-dihydrobenzimidazole-4-carboxylic acid |
| InChIKey | NEGPAVSXSLHMAR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)NC(=O)N2)C(=O)O |
Computed by PubChem (NCBI)