cas: 51362-08-4 — see every product listed under this CAS number, including other names
2-Phenoxyisonicotinic acid 95+% (CAS 51362-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A656058-1g |
| cas | 51362-08-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 809.81 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A656058 |
2-phenoxypyridine-4-carboxylic acid (CAS 51362-08-4) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 2-phenoxypyridine-4-carboxylic acid. InChIKey: MVRLAYNMGBRJTD-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 2-phenoxypyridine-4-carboxylic acid |
| InChIKey | MVRLAYNMGBRJTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)