cas: 25797-03-9 — see every product listed under this CAS number, including other names
2-Phenyl-1H-pyrrolo[3,2-b]pyridine 95% (CAS 25797-03-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A191979-100mg |
| cas | 25797-03-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 704.12 Pln | |
| Ambeed | 5g | 2372.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A191979 |
2-phenyl-1H-pyrrolo[3,2-b]pyridine (CAS 25797-03-9) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-phenyl-1H-pyrrolo[3,2-b]pyridine. InChIKey: MHTVGGZESFVQIQ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-phenyl-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | MHTVGGZESFVQIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C=CC=N3 |
Computed by PubChem (NCBI)