cas: 25797-03-9 — see every product listed under this CAS number, including other names
2-Phenyl-4-azaindole, 95%, 95% (CAS 25797-03-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BHKK-100mg |
| cas | 25797-03-9 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 184.40 Pln | |
| Chemat | 250mg | 270.80 Pln | |
| Chemat | 1g | 654.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-phenyl-1H-pyrrolo[3,2-b]pyridine (CAS 25797-03-9) is a chemical compound with the molecular formula C13H10N2 and a molecular weight of 194.23 g/mol. IUPAC name: 2-phenyl-1H-pyrrolo[3,2-b]pyridine. InChIKey: MHTVGGZESFVQIQ-UHFFFAOYSA-N.
| Molecular formula | C13H10N2 |
|---|---|
| Molecular weight | 194.23 g/mol |
| IUPAC name | 2-phenyl-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | MHTVGGZESFVQIQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(N2)C=CC=N3 |
Computed by PubChem (NCBI)