cas: 952-47-6 — see every product listed under this CAS number, including other names
2-Phenylazo-4-methylphenol, ≥98%, ≥98% (CAS 952-47-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114HV6-1g |
| cas | 952-47-6 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 501.20 Pln | |
| Chemat | 25g | 1398.80 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
4-methyl-2-phenyldiazenylphenol (CAS 952-47-6) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 4-methyl-2-phenyldiazenylphenol. InChIKey: NJOXSODFMZIZJD-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 4-methyl-2-phenyldiazenylphenol |
| InChIKey | NJOXSODFMZIZJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)O)N=NC2=CC=CC=C2 |
Computed by PubChem (NCBI)