CAS 855360-81-5 is the registry number for 5-Methyl-1,10-phenanthroline hydrate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg.
5-methyl-1,10-phenanthroline;hydrate (CAS 855360-81-5) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 5-methyl-1,10-phenanthroline;hydrate. InChIKey: KEEIWUCDQWFEHU-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 5-methyl-1,10-phenanthroline;hydrate |
| InChIKey | KEEIWUCDQWFEHU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C3=C1C=CC=N3)N=CC=C2.O |
Computed by PubChem (NCBI)