CAS 6320-63-4 appears in our catalog under these names: N-Benzylpyridine-4-carboxamide, N-Benzylpyridine-4-carboxamide, 95%, N-Benzylisonicotinamide, 95%, 95%. Offered by: Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 2,5g, 10g, 5g, 1g, 250mg.
N-benzylpyridine-4-carboxamide (CAS 6320-63-4) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: N-benzylpyridine-4-carboxamide. InChIKey: YIGMDKYIWMVZDV-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | N-benzylpyridine-4-carboxamide |
| InChIKey | YIGMDKYIWMVZDV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)