CAS 13262-48-1 appears in our catalog under these names: 1-((1,1'-Biphenyl)-4-yl)urea, 97%, (4-Phenylphenyl)urea, 95%, (4-Phenylphenyl)urea, Biphenyl-4-ylurea 97%, 1-([1,1'-Biphenyl]-4-yl)urea, 97%, 97%. Offered by: AmBeed, Combi-blocks, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 0,1g, 0,05g, 0,25g.
(4-phenylphenyl)urea (CAS 13262-48-1) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: (4-phenylphenyl)urea. InChIKey: FAVOSJNIJZMFAB-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (4-phenylphenyl)urea |
| InChIKey | FAVOSJNIJZMFAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC(=O)N |
Computed by PubChem (NCBI)