CAS 4424-17-3 appears in our catalog under these names: 2-Aminobenzanilide, 97%, 2–AMINOBENZANILIDE, 2-Aminobenzanilide, 2-Amino-N-phenylbenzamide, >95.0%(HPLC)(T), 2-Aminobenzanilide 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, TCI. Available pack sizes: 1g, 25g, 5g, 50mg, 0,5g, 200mg, 2g, 10g.
2-amino-N-phenylbenzamide (CAS 4424-17-3) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: 2-amino-N-phenylbenzamide. InChIKey: FDPVTENMNDHFNK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | 2-amino-N-phenylbenzamide |
| InChIKey | FDPVTENMNDHFNK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)C2=CC=CC=C2N |
Computed by PubChem (NCBI)