CAS 721-47-1 appears in our catalog under these names: N-(2-Aminophenyl)benzamide, 95%, N-(2-Aminophenyl)benzamide, 95+%, n-(2-Aminophenyl)benzamide. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 25g, 50mg.
N-(2-aminophenyl)benzamide (CAS 721-47-1) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: N-(2-aminophenyl)benzamide. InChIKey: RFDVMOUXHKTCDO-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | N-(2-aminophenyl)benzamide |
| InChIKey | RFDVMOUXHKTCDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC=C2N |
Computed by PubChem (NCBI)