CAS 39070-63-8 appears in our catalog under these names: 3,4-Diaminobenzophenone, 95%, 3,4-Diamino Benzophenone, 3,4-Diaminobenzophenone, 3,4–Diaminobenzophenone, 3,4-Diaminobenzophenone, >98.0%(GC)(T). Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Biosynth. Available pack sizes: 25g, 5g, 1g, 100g, on request, 10g, 500g, 0,05kg.
(3,4-diaminophenyl)-phenylmethanone (CAS 39070-63-8) is a chemical compound with the molecular formula C13H12N2O and a molecular weight of 212.25 g/mol. IUPAC name: (3,4-diaminophenyl)-phenylmethanone. InChIKey: RXCOGDYOZQGGMK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (3,4-diaminophenyl)-phenylmethanone |
| InChIKey | RXCOGDYOZQGGMK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C=C2)N)N |
Computed by PubChem (NCBI)