2-Phenylquinolin-6-amine, 97%
cas: 863770-87-0 — see every product listed under this CAS number, including other names
2-Phenylquinolin-6-amine, 97% (CAS 863770-87-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F898038-100MG |
| cas | 863770-87-0 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1148.57 Pln | |
| Fluorochem | 1g | 2934.40 Pln | |
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 909.94 Pln | |
| Ambeed | 1g | 2345.06 Pln | |
| Chemat | 100mg | 429.20 Pln | |
| Chemat | 250mg | 688.40 Pln | |
| Chemat | 1g | 1749.20 Pln | |
| BLDpharm | 100mg | 608.70 Pln | |
| BLDpharm | 250mg | 975.24 Pln | |
| BLDpharm | 1g | 2524.69 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-phenylquinolin-6-amine (CAS 863770-87-0) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 2-phenylquinolin-6-amine. InChIKey: RMDMSKUNPMSRME-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 2-phenylquinolin-6-amine |
| InChIKey | RMDMSKUNPMSRME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=C2)C=C(C=C3)N |
Computed by PubChem (NCBI)