CAS 5855-52-7 appears in our catalog under these names: 2-Phenylquinolin-4-amine, 95%, 2-Phenylquinolin-4-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
2-phenylquinolin-4-amine (CAS 5855-52-7) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 2-phenylquinolin-4-amine. InChIKey: URUHKHGBRNTPGA-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 2-phenylquinolin-4-amine |
| InChIKey | URUHKHGBRNTPGA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3C(=C2)N |
Computed by PubChem (NCBI)