CAS 108085-60-5 is the registry number for 1-((1,1'-Biphenyl)-4-yl)-1H-imidazole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-(4-phenylphenyl)imidazole (CAS 108085-60-5) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 1-(4-phenylphenyl)imidazole. InChIKey: FFRBVGATVOCVAZ-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 1-(4-phenylphenyl)imidazole |
| InChIKey | FFRBVGATVOCVAZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)N3C=CN=C3 |
Computed by PubChem (NCBI)