CAS 108618-27-5 appears in our catalog under these names: N-Phenylquinolin-3-amine, 95%, N-Phenylquinolin-3-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg.
N-phenylquinolin-3-amine (CAS 108618-27-5) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: N-phenylquinolin-3-amine. InChIKey: RJAKKBANTMOIKE-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | N-phenylquinolin-3-amine |
| InChIKey | RJAKKBANTMOIKE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC3=CC=CC=C3N=C2 |
Computed by PubChem (NCBI)