CAS 104988-73-0 is the registry number for 2-(Quinolin-3-yl)aniline, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-quinolin-3-ylaniline (CAS 104988-73-0) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 2-quinolin-3-ylaniline. InChIKey: HWFVBFWEZZFAEB-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 2-quinolin-3-ylaniline |
| InChIKey | HWFVBFWEZZFAEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(C=N2)C3=CC=CC=C3N |
Computed by PubChem (NCBI)