CAS 36926-84-8 appears in our catalog under these names: 2-Amino-3-phenylquinoline, 95%, 3-Phenylquinolin-2-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g, 250mg.
3-phenylquinolin-2-amine (CAS 36926-84-8) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 3-phenylquinolin-2-amine. InChIKey: CIHDZAQRRFHMLW-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 3-phenylquinolin-2-amine |
| InChIKey | CIHDZAQRRFHMLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=CC=CC=C3N=C2N |
Computed by PubChem (NCBI)