CAS 52179-66-5 is the registry number for 1,2-Diphenyl-1H-imidazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,2-diphenylimidazole (CAS 52179-66-5) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: 1,2-diphenylimidazole. InChIKey: JNZXFLAEEPPCSN-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | 1,2-diphenylimidazole |
| InChIKey | JNZXFLAEEPPCSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=CN2C3=CC=CC=C3 |
Computed by PubChem (NCBI)