Products 2092613-79-9
CAS 2092613-79-9 is the registry number for 4-Bromo-2-(difluoromethoxy)-6-fluorobenzonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2-(difluoromethoxy)-6-fluorobenzonitrile (CAS 2092613-79-9) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 4-bromo-2-(difluoromethoxy)-6-fluorobenzonitrile. InChIKey: WFZHBHKNULAFPC-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 4-bromo-2-(difluoromethoxy)-6-fluorobenzonitrile |
| InChIKey | WFZHBHKNULAFPC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)F)C#N)F)Br |
Computed by PubChem (NCBI)