CAS 186589-12-8 is the registry number for 4–Bromo–2–(trifluoromethyl)phenyl isocyanate. Offered by: GLPBio. Available pack sizes: 1g, 5g.
4-bromo-1-isocyanato-2-(trifluoromethyl)benzene (CAS 186589-12-8) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 4-bromo-1-isocyanato-2-(trifluoromethyl)benzene. InChIKey: UZFHKVBCBXPKKE-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 4-bromo-1-isocyanato-2-(trifluoromethyl)benzene |
| InChIKey | UZFHKVBCBXPKKE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(F)(F)F)N=C=O |
Computed by PubChem (NCBI)