Products 1260790-58-6
CAS 1260790-58-6 appears in our catalog under these names: 5-Bromo-3-(trifluoromethyl)benzo(d)isoxazole, 95+%, 5-Bromo-3-(trifluoromethyl)-1,2-benzoxazole. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-bromo-3-(trifluoromethyl)-1,2-benzoxazole (CAS 1260790-58-6) is a chemical compound with the molecular formula C8H3BrF3NO and a molecular weight of 266.01 g/mol. IUPAC name: 5-bromo-3-(trifluoromethyl)-1,2-benzoxazole. InChIKey: XCFRAFMNVAYGDH-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NO |
|---|---|
| Molecular weight | 266.01 g/mol |
| IUPAC name | 5-bromo-3-(trifluoromethyl)-1,2-benzoxazole |
| InChIKey | XCFRAFMNVAYGDH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=NO2)C(F)(F)F |
Computed by PubChem (NCBI)