cas: 139719-24-7 — see every product listed under this CAS number, including other names
2-chloro-4,6,8-trimethylquinoline, 95%, 95% (CAS 139719-24-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112BKQ-100mg |
| cas | 139719-24-7 |
| size | 100mg |
| availability | 27g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 856.40 Pln | |
| Chemat | 250mg | 1192.40 Pln | |
| Chemat | 1g | 2344.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-chloro-4,6,8-trimethylquinoline (CAS 139719-24-7) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 2-chloro-4,6,8-trimethylquinoline. InChIKey: QELGNYILIXTHBQ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-chloro-4,6,8-trimethylquinoline |
| InChIKey | QELGNYILIXTHBQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)Cl)C)C |
Computed by PubChem (NCBI)