CAS 32570-14-2 appears in our catalog under these names: 1-(3-Chlorophenyl)-2,5-dimethyl-1h-pyrrole, 95%, 1-(3-Chlorophenyl)-2,5-dimethyl-1H-pyrrole, 98%, 1-(3-Chlorophenyl)-2,5-dimethyl-1H-pyrrole. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
1-(3-chlorophenyl)-2,5-dimethylpyrrole (CAS 32570-14-2) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 1-(3-chlorophenyl)-2,5-dimethylpyrrole. InChIKey: BIBIJBWTHPHLNZ-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 1-(3-chlorophenyl)-2,5-dimethylpyrrole |
| InChIKey | BIBIJBWTHPHLNZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC(=CC=C2)Cl)C |
Computed by PubChem (NCBI)