Products 32386-87-1

CAS 32386-87-1 appears in our catalog under these names: 1H-Benz(de)isoquinoline, 2,3-dihydro-, hydrochloride, 95%, 2,3-Dihydro-1H-benzo(de)isoquinoline hydrochloride, 97%, 2,3-Dihydro-1H-benzo(de)isoquinoline hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 100mg, 2,5g.

Structural formula: {0} (CAS {1})

2,3-dihydro-1H-benzo[de]isoquinoline;hydrochloride (CAS 32386-87-1) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 2,3-dihydro-1H-benzo[de]isoquinoline;hydrochloride. InChIKey: RHJYITSOKPRKHB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12ClN
Molecular weight205.68 g/mol
IUPAC name2,3-dihydro-1H-benzo[de]isoquinoline;hydrochloride
InChIKeyRHJYITSOKPRKHB-UHFFFAOYSA-N
SMILESC1C2=CC=CC3=C2C(=CC=C3)CN1.Cl

Computed by PubChem (NCBI)