CAS 63136-64-1 is the registry number for 4-Chloro-2,5,7-trimethylquinoline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
4-chloro-2,5,7-trimethylquinoline (CAS 63136-64-1) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 4-chloro-2,5,7-trimethylquinoline. InChIKey: IQBVBMMNGRIPEI-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 4-chloro-2,5,7-trimethylquinoline |
| InChIKey | IQBVBMMNGRIPEI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)N=C(C=C2Cl)C)C |
Computed by PubChem (NCBI)