CAS 329210-71-1 appears in our catalog under these names: 2-Chloro-4,5,7-trimethylquinoline, 95%, 2-Chloro-4,5,7-trimethylquinoline, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 5g, 25g.
2-chloro-4,5,7-trimethylquinoline (CAS 329210-71-1) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 2-chloro-4,5,7-trimethylquinoline. InChIKey: LPTKXGDEXQXRMU-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-chloro-4,5,7-trimethylquinoline |
| InChIKey | LPTKXGDEXQXRMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=CC(=NC2=C1)Cl)C)C |
Computed by PubChem (NCBI)