CAS 5044-23-5 appears in our catalog under these names: 1-(4-Chlorophenyl)-2,5-dimethylpyrrole, 98%, 1–(4–Chlorophenyl)–2,5–dimethylpyrrole, 1-(4-Chlorophenyl)-2,5-dimethylpyrrole, >98.0%(GC), 1-(4-Chlorophenyl)-2,5-dimethyl-1H-pyrrole 95%, 1-(4-Chlorophenyl)-2,5-dimethylpyrrole, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 5g, -, 250mg, 10g.
1-(4-chlorophenyl)-2,5-dimethylpyrrole (CAS 5044-23-5) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,5-dimethylpyrrole. InChIKey: NNKFIFOSLJJRES-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,5-dimethylpyrrole |
| InChIKey | NNKFIFOSLJJRES-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(N1C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)