CAS 58306-99-3 appears in our catalog under these names: 1,2-Dihydroacenaphthylenamine hydrochloride, 95%, 1,2-Dihydroacenaphthylen-5-amine hydrochloride, 95%, 1,2-Dihydroacenaphthylen-5-amine hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
1,2-dihydroacenaphthylen-5-amine;hydrochloride (CAS 58306-99-3) is a chemical compound with the molecular formula C12H12ClN and a molecular weight of 205.68 g/mol. IUPAC name: 1,2-dihydroacenaphthylen-5-amine;hydrochloride. InChIKey: PIDNLFLDFVUKPR-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 1,2-dihydroacenaphthylen-5-amine;hydrochloride |
| InChIKey | PIDNLFLDFVUKPR-UHFFFAOYSA-N |
| SMILES | C1CC2=CC=C(C3=CC=CC1=C23)N.Cl |
Computed by PubChem (NCBI)