cas: 1736-56-7 — see every product listed under this CAS number, including other names
2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde (CAS 1736-56-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112Z3A-250mg |
| cas | 1736-56-7 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 347.60 Pln | |
| Chemat | 1g | 885.20 Pln |
| delivery time | 3 weeks |
|---|
2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde (CAS 1736-56-7) is a chemical compound with the molecular formula C9H5F3O2 and a molecular weight of 202.13 g/mol. IUPAC name: 2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde. InChIKey: BGOMXTCPIUNFKR-UHFFFAOYSA-N.
| Molecular formula | C9H5F3O2 |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 2-oxo-2-[4-(trifluoromethyl)phenyl]acetaldehyde |
| InChIKey | BGOMXTCPIUNFKR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C=O)C(F)(F)F |
Computed by PubChem (NCBI)