cas: 221018-03-7 — see every product listed under this CAS number, including other names
3',5'-Difluoro-[1,1'-biphenyl]-4-carbaldehyde 97% (CAS 221018-03-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A481651-100mg |
| cas | 221018-03-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 281.38 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 637.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A481651 |
4-(3,5-difluorophenyl)benzaldehyde (CAS 221018-03-7) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: 4-(3,5-difluorophenyl)benzaldehyde. InChIKey: KKOQMGVTGKBJBL-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | 4-(3,5-difluorophenyl)benzaldehyde |
| InChIKey | KKOQMGVTGKBJBL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)