cas: 7463-31-2 — see every product listed under this CAS number, including other names
3'-Acetamidoacetophenone, >98.0%(GC) (CAS 7463-31-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 500g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A1408-25G |
| cas | 7463-31-2 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 128.18 Pln | |
| TCI | 500g | 1175.55 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC) |
N-(3-acetylphenyl)acetamide (CAS 7463-31-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N-(3-acetylphenyl)acetamide. InChIKey: AFZTYHRVDOKRKV-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N-(3-acetylphenyl)acetamide |
| InChIKey | AFZTYHRVDOKRKV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)C |
Computed by PubChem (NCBI)