cas: 7463-31-2 — see every product listed under this CAS number, including other names
3'-Acetamidoacetophenone, 95% (CAS 7463-31-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F209741-1G |
| cas | 7463-31-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 25g | 138.51 Pln | |
| Fluorochem | 10g | 138.51 Pln | |
| Fluorochem | 100g | 378.01 Pln | |
| Fluorochem | 500g | 1637.98 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
N-(3-acetylphenyl)acetamide (CAS 7463-31-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N-(3-acetylphenyl)acetamide. InChIKey: AFZTYHRVDOKRKV-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N-(3-acetylphenyl)acetamide |
| InChIKey | AFZTYHRVDOKRKV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)C |
Computed by PubChem (NCBI)