cas: 7463-31-2 — see every product listed under this CAS number, including other names
Acetamide, N-(3-acetylphenyl)-, 98%, 98% (CAS 7463-31-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ISM-1g |
| cas | 7463-31-2 |
| size | 1g |
| availability | 1000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 25g | 117.20 Pln | |
| Chemat | 100g | 251.60 Pln | |
| Chemat | 500g | 840.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-(3-acetylphenyl)acetamide (CAS 7463-31-2) is a chemical compound with the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. IUPAC name: N-(3-acetylphenyl)acetamide. InChIKey: AFZTYHRVDOKRKV-UHFFFAOYSA-N.
| Molecular formula | C10H11NO2 |
|---|---|
| Molecular weight | 177.20 g/mol |
| IUPAC name | N-(3-acetylphenyl)acetamide |
| InChIKey | AFZTYHRVDOKRKV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=CC=C1)NC(=O)C |
Computed by PubChem (NCBI)